C14H16ClNO3 — CID 132544966
(3aR,4R,7aR)-4-chloro-3-(4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 132544966) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is (3aR,4R,7aR)-4-chloro-3-(4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aR,4R,7aR)-4-chloro-3-(4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 132544966 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (3aR,4R,7aR)-4-chloro-3-(4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(N2C(=O)O[C@@H]3CCC[C@@H](Cl)[C@@H]32)cc1 |
| InChI | InChI=1S/C14H16ClNO3/c1-18-10-7-5-9(6-8-10)16-13-11(15)3-2-4-12(13)19-14(16)17/h5-8,11-13H,2-4H2,1H3/t11-,12-,13+/m1/s1 |
| InChIKey | VLRSBPQAMNTZRV-UPJWGTAASA-N |
| XLogP | 3.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|