C18H22ClNO3 — CID 132544968
(3aR,4R,6S,7aR)-4-chloro-3-(4-methoxyphenyl)-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-one (PubChem CID 132544968) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is (3aR,4R,6S,7aR)-4-chloro-3-(4-methoxyphenyl)-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-one.
| Compound Name | (3aR,4R,6S,7aR)-4-chloro-3-(4-methoxyphenyl)-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 132544968 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3aR,4R,6S,7aR)-4-chloro-3-(4-methoxyphenyl)-3a-methyl-6-prop-1-en-2-yl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-one |
| SMILES | C=C(C)[C@@H]1C[C@@H](Cl)[C@@]2(C)[C@@H](C1)OC(=O)N2c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H22ClNO3/c1-11(2)12-9-15(19)18(3)16(10-12)23-17(21)20(18)13-5-7-14(22-4)8-6-13/h5-8,12,15-16H,1,9-10H2,2-4H3/t12-,15-,16-,18+/m1/s1 |
| InChIKey | KYCHCKWRRDZWAQ-YMCQQKJTSA-N |
| XLogP | 4.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|