C18H23NO3 — CID 132546579
(1R,12S,16R)-4-ethoxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-10-one (PubChem CID 132546579) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (1R,12S,16R)-4-ethoxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-10-one.
| Compound Name | (1R,12S,16R)-4-ethoxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-10-one |
|---|---|
| PubChem CID | 132546579 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (1R,12S,16R)-4-ethoxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-10-one |
| SMILES | CCOc1cc2c(cc1OC)CN1C(=O)C[C@@H]3CCC[C@H]2[C@@H]31 |
| InChI | InChI=1S/C18H23NO3/c1-3-22-16-9-14-12(7-15(16)21-2)10-19-17(20)8-11-5-4-6-13(14)18(11)19/h7,9,11,13,18H,3-6,8,10H2,1-2H3/t11-,13+,18+/m0/s1 |
| InChIKey | KDPGGSHSELOCSM-WHWRDJHUSA-N |
| XLogP | 3.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |