C27H24N2O5S2 — CID 132547966
1,2-bis-(4-methylphenyl)sulfonyl-5-naphthalen-2-ylpyrazolidin-3-one (PubChem CID 132547966) has the molecular formula C27H24N2O5S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1,2-bis-(4-methylphenyl)sulfonyl-5-naphthalen-2-ylpyrazolidin-3-one.
| Compound Name | 1,2-bis-(4-methylphenyl)sulfonyl-5-naphthalen-2-ylpyrazolidin-3-one |
|---|---|
| PubChem CID | 132547966 |
| Molecular Formula | C27H24N2O5S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 1,2-bis-(4-methylphenyl)sulfonyl-5-naphthalen-2-ylpyrazolidin-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC(c3ccc4ccccc4c3)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O5S2/c1-19-7-13-24(14-8-19)35(31,32)28-26(23-12-11-21-5-3-4-6-22(21)17-23)18-27(30)29(28)36(33,34)25-15-9-20(2)10-16-25/h3-17,26H,18H2,1-2H3 |
| InChIKey | TVXOBUPIEYDYIP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |