C29H26N2O3S — CID 166444039
(2R,3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-4-naphthalen-2-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol (PubChem CID 166444039) has the molecular formula C29H26N2O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is (2R,3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-4-naphthalen-2-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol.
| Compound Name | (2R,3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-4-naphthalen-2-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol |
|---|---|
| PubChem CID | 166444039 |
| Molecular Formula | C29H26N2O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (2R,3R,4S)-3-methyl-1-(4-methylphenyl)sulfonyl-4-naphthalen-2-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2c3[nH]c4ccccc4c3[C@H](c3ccc4ccccc4c3)[C@@H](C)[C@H]2O)cc1 |
| InChI | InChI=1S/C29H26N2O3S/c1-18-11-15-23(16-12-18)35(33,34)31-28-27(24-9-5-6-10-25(24)30-28)26(19(2)29(31)32)22-14-13-20-7-3-4-8-21(20)17-22/h3-17,19,26,29-30,32H,1-2H3/t19-,26+,29-/m1/s1 |
| InChIKey | NQBNTABGECFUHU-WBZRNCBQSA-N |
| XLogP | 5.92 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |