C23H22N2O3S2 — CID 166444040
(2R,3R,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol (PubChem CID 166444040) has the molecular formula C23H22N2O3S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is (2R,3R,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol.
| Compound Name | (2R,3R,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol |
|---|---|
| PubChem CID | 166444040 |
| Molecular Formula | C23H22N2O3S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (2R,3R,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2,3,4,9-tetrahydropyrido[2,3-b]indol-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2c3[nH]c4ccccc4c3[C@H](c3ccsc3)[C@@H](C)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H22N2O3S2/c1-14-7-9-17(10-8-14)30(27,28)25-22-21(18-5-3-4-6-19(18)24-22)20(15(2)23(25)26)16-11-12-29-13-16/h3-13,15,20,23-24,26H,1-2H3/t15-,20+,23-/m1/s1 |
| InChIKey | IPXSSJGIFMDPSM-ZNRXUEPQSA-N |
| XLogP | 4.83 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |