C19H20ClNO3S2 — CID 139048948
(3R,3aS,4S,7aS)-4-chloro-1-(4-methylphenyl)sulfonyl-3-thiophen-3-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 139048948) has the molecular formula C19H20ClNO3S2 and a molecular weight of 409.96 g/mol. Its IUPAC name is (3R,3aS,4S,7aS)-4-chloro-1-(4-methylphenyl)sulfonyl-3-thiophen-3-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | (3R,3aS,4S,7aS)-4-chloro-1-(4-methylphenyl)sulfonyl-3-thiophen-3-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 139048948 |
| Molecular Formula | C19H20ClNO3S2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (3R,3aS,4S,7aS)-4-chloro-1-(4-methylphenyl)sulfonyl-3-thiophen-3-yl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)[C@@H](c3ccsc3)[C@@H]3[C@@H](Cl)CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H20ClNO3S2/c1-12-5-7-14(8-6-12)26(23,24)21-16-4-2-3-15(20)18(16)17(19(21)22)13-9-10-25-11-13/h5-11,15-18H,2-4H2,1H3/t15-,16-,17-,18+/m0/s1 |
| InChIKey | KJSIAEPFEXRCBI-XLAORIBOSA-N |
| XLogP | 4.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|