C32H40F18N2O7Si — CID 132548968
[2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(4-trimethoxysilylbutyl)carbamate (PubChem CID 132548968) has the molecular formula C32H40F18N2O7Si and a molecular weight of 934.73 g/mol. Its IUPAC name is [2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(4-trimethoxysilylbutyl)carbamate.
| Compound Name | [2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(4-trimethoxysilylbutyl)carbamate |
|---|---|
| PubChem CID | 132548968 |
| Molecular Formula | C32H40F18N2O7Si |
| Molecular Weight | 934.73 g/mol |
| Exact Mass | 934.23 |
| IUPAC Name | [2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(4-trimethoxysilylbutyl)carbamate |
| SMILES | CO[Si](CCCCNC(=O)OC(c1cc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-])C(C)C)(OC)OC |
| InChI | InChI=1S/C32H40F18N2O7Si/c1-18(2)23(59-24(53)51-14-6-7-15-60(56-3,57-4)58-5)21-16-19(10-8-12-25(33,34)27(37,38)29(41,42)31(45,46)47)20(17-22(21)52(54)55)11-9-13-26(35,36)28(39,40)30(43,44)32(48,49)50/h16-18,23H,6-15H2,1-5H3,(H,51,53) |
| InChIKey | PUEWZGNSKLHKCT-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.73 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|