C28H27O2PS — CID 132549144
2-[diphenylphosphoryl-(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 132549144) has the molecular formula C28H27O2PS and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[diphenylphosphoryl-(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[diphenylphosphoryl-(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 132549144 |
| Molecular Formula | C28H27O2PS |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-[diphenylphosphoryl-(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | COc1ccc(C(c2cc3c(s2)CCCC3)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27O2PS/c1-30-23-18-16-21(17-19-23)28(27-20-22-10-8-9-15-26(22)32-27)31(29,24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-7,11-14,16-20,28H,8-10,15H2,1H3 |
| InChIKey | HOIYUOOENLYLPZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|