C14H15BrO — CID 132551590
(3S,4S)-3-bromo-1-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one (PubChem CID 132551590) has the molecular formula C14H15BrO and a molecular weight of 279.18 g/mol. Its IUPAC name is (3S,4S)-3-bromo-1-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one.
| Compound Name | (3S,4S)-3-bromo-1-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 132551590 |
| Molecular Formula | C14H15BrO |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (3S,4S)-3-bromo-1-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one |
| SMILES | CC1C[C@H](Br)[C@@]2(CCC2=O)c2ccccc21 |
| InChI | InChI=1S/C14H15BrO/c1-9-8-12(15)14(7-6-13(14)16)11-5-3-2-4-10(9)11/h2-5,9,12H,6-8H2,1H3/t9?,12-,14+/m0/s1 |
| InChIKey | NFOXQFGDBDZREX-RAYMKUHOSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|