C24H36O8SSi — CID 132553824
[(E)-3-[(2R)-5-(benzenesulfonyl)-6-oxooxan-2-yl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl] ethyl carbonate (PubChem CID 132553824) has the molecular formula C24H36O8SSi and a molecular weight of 512.70 g/mol. Its IUPAC name is [(E)-3-[(2R)-5-(benzenesulfonyl)-6-oxooxan-2-yl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl] ethyl carbonate.
| Compound Name | [(E)-3-[(2R)-5-(benzenesulfonyl)-6-oxooxan-2-yl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 132553824 |
| Molecular Formula | C24H36O8SSi |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [(E)-3-[(2R)-5-(benzenesulfonyl)-6-oxooxan-2-yl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C(=C\[C@H]1CCC(C(=O)O1)S(=O)(=O)C2=CC=CC=C2)/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36O8SSi/c1-7-29-23(26)30-16-18(17-31-34(5,6)24(2,3)4)15-19-13-14-21(22(25)32-19)33(27,28)20-11-9-8-10-12-20/h8-12,15,19,21H,7,13-14,16-17H2,1-6H3/b18-15+/t19-,21?/m1/s1 |
| InChIKey | NHKMKGBJLPZNFR-ZXNPBCBPSA-N |
| XLogP | — |
| TPSA | 114.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | 832 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|