C28H46O6SSi — CID 10875201
methyl 2-(benzenesulfonyl)-10-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]decanoate (PubChem CID 10875201) has the molecular formula C28H46O6SSi and a molecular weight of 538.82 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-10-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]decanoate.
| Compound Name | methyl 2-(benzenesulfonyl)-10-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]decanoate |
|---|---|
| PubChem CID | 10875201 |
| Molecular Formula | C28H46O6SSi |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-10-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]decanoate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1CCCCCCCCC(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H46O6SSi/c1-22(21-33-36(6,7)28(2,3)4)26-24(34-26)19-15-10-8-9-11-16-20-25(27(29)32-5)35(30,31)23-17-13-12-14-18-23/h12-14,17-18,24-26H,1,8-11,15-16,19-21H2,2-7H3/t24-,25?,26-/m0/s1 |
| InChIKey | AKLRNJVNFVEITC-ZURQMKNRSA-N |
| XLogP | 6.47 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|