C27H44O6SSi — CID 10602159
methyl 2-(benzenesulfonyl)-9-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]nonanoate (PubChem CID 10602159) has the molecular formula C27H44O6SSi and a molecular weight of 524.80 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-9-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]nonanoate.
| Compound Name | methyl 2-(benzenesulfonyl)-9-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]nonanoate |
|---|---|
| PubChem CID | 10602159 |
| Molecular Formula | C27H44O6SSi |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-9-[(2S,3S)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]oxiran-2-yl]nonanoate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1CCCCCCCC(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H44O6SSi/c1-21(20-32-35(6,7)27(2,3)4)25-23(33-25)18-14-9-8-10-15-19-24(26(28)31-5)34(29,30)22-16-12-11-13-17-22/h11-13,16-17,23-25H,1,8-10,14-15,18-20H2,2-7H3/t23-,24?,25-/m0/s1 |
| InChIKey | JABIWXDBBIQUQS-PFIFLBKHSA-N |
| XLogP | 6.08 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|