C23H36O6SSi — CID 11037994
methyl 2-(benzenesulfonyl)-2-[(3R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,6-dihydro-2H-pyran-3-yl]acetate (PubChem CID 11037994) has the molecular formula C23H36O6SSi and a molecular weight of 468.69 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-2-[(3R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,6-dihydro-2H-pyran-3-yl]acetate.
| Compound Name | methyl 2-(benzenesulfonyl)-2-[(3R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,6-dihydro-2H-pyran-3-yl]acetate |
|---|---|
| PubChem CID | 11037994 |
| Molecular Formula | C23H36O6SSi |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-2-[(3R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,6-dihydro-2H-pyran-3-yl]acetate |
| SMILES | COC(=O)C([C@@H]1C=C[C@H](CC(C)O[Si](C)(C)C(C)(C)C)OC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H36O6SSi/c1-17(29-31(6,7)23(2,3)4)15-19-14-13-18(16-28-19)21(22(24)27-5)30(25,26)20-11-9-8-10-12-20/h8-14,17-19,21H,15-16H2,1-7H3/t17?,18-,19-,21?/m1/s1 |
| InChIKey | RLFZKARVMRFQLD-XTBIFASLSA-N |
| XLogP | 4.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|