C10H15F3N2O2 — CID 132555185
(2R,7R,8aR)-7-hydroxy-2,8a-dimethyl-7-(trifluoromethyl)-2,3,6,8-tetrahydro-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 132555185) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is (2R,7R,8aR)-7-hydroxy-2,8a-dimethyl-7-(trifluoromethyl)-2,3,6,8-tetrahydro-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | (2R,7R,8aR)-7-hydroxy-2,8a-dimethyl-7-(trifluoromethyl)-2,3,6,8-tetrahydro-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 132555185 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2R,7R,8aR)-7-hydroxy-2,8a-dimethyl-7-(trifluoromethyl)-2,3,6,8-tetrahydro-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | C[C@@H]1CN2C(=O)C[C@@](O)(C(F)(F)F)C[C@]2(C)N1 |
| InChI | InChI=1S/C10H15F3N2O2/c1-6-4-15-7(16)3-9(17,10(11,12)13)5-8(15,2)14-6/h6,14,17H,3-5H2,1-2H3/t6-,8-,9+/m1/s1 |
| InChIKey | BUQUZSSKUWTPKU-VDAHYXPESA-N |
| XLogP | 0.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |