C55H86N2S2+2 — CID 132557819
6-[2,7-bis(5-octylthiophen-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium (PubChem CID 132557819) has the molecular formula C55H86N2S2+2 and a molecular weight of 839.44 g/mol. Its IUPAC name is 6-[2,7-bis(5-octylthiophen-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium.
| Compound Name | 6-[2,7-bis(5-octylthiophen-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 132557819 |
| Molecular Formula | C55H86N2S2+2 |
| Molecular Weight | 839.44 g/mol |
| Exact Mass | 838.62 |
| IUPAC Name | 6-[2,7-bis(5-octylthiophen-2-yl)-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium |
| SMILES | CCCCCCCCc1ccc(-c2ccc3c(c2)C(CCCCCC[N+](C)(C)C)(CCCCCC[N+](C)(C)C)c2cc(-c4ccc(CCCCCCCC)s4)ccc2-3)s1 |
| InChI | InChI=1S/C55H86N2S2/c1-9-11-13-15-17-23-29-47-33-37-53(58-47)45-31-35-49-50-36-32-46(54-38-34-48(59-54)30-24-18-16-14-12-10-2)44-52(50)55(51(49)43-45,39-25-19-21-27-41-56(3,4)5)40-26-20-22-28-42-57(6,7)8/h31-38,43-44H,9-30,39-42H2,1-8H3/q+2 |
| InChIKey | TYVWELGHEHLQSC-UHFFFAOYSA-N |
| XLogP | 16.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.44 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|