C11H10O2 — CID 132563821
(E)-3-[2-[(E)-3-oxoprop-1-enyl]cyclopenta-2,4-dien-1-yl]prop-2-enal (PubChem CID 132563821) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (E)-3-[2-[(E)-3-oxoprop-1-enyl]cyclopenta-2,4-dien-1-yl]prop-2-enal.
| Compound Name | (E)-3-[2-[(E)-3-oxoprop-1-enyl]cyclopenta-2,4-dien-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 132563821 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (E)-3-[2-[(E)-3-oxoprop-1-enyl]cyclopenta-2,4-dien-1-yl]prop-2-enal |
| SMILES | O=C/C=C/C1=CC=CC1/C=C/C=O |
| InChI | InChI=1S/C11H10O2/c12-8-2-6-10-4-1-5-11(10)7-3-9-13/h1-10H/b6-2+,7-3+ |
| InChIKey | IKLDSEFVPKIWIP-YPCIICBESA-N |
| XLogP | 1.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|