C12H10O — CID 15190502
(E)-3-(6-ethynylcyclohepta-1,3,5-trien-1-yl)prop-2-enal (PubChem CID 15190502) has the molecular formula C12H10O and a molecular weight of 170.21 g/mol. Its IUPAC name is (E)-3-(6-ethynylcyclohepta-1,3,5-trien-1-yl)prop-2-enal.
| Compound Name | (E)-3-(6-ethynylcyclohepta-1,3,5-trien-1-yl)prop-2-enal |
|---|---|
| PubChem CID | 15190502 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (E)-3-(6-ethynylcyclohepta-1,3,5-trien-1-yl)prop-2-enal |
| SMILES | C#CC1=CC=CC=C(/C=C/C=O)C1 |
| InChI | InChI=1S/C12H10O/c1-2-11-6-3-4-7-12(10-11)8-5-9-13/h1,3-9H,10H2/b8-5+ |
| InChIKey | MVIOZHDZPSENHV-VMPITWQZSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|