C26H22S — CID 10522952
1-ethynyl-6-[(1E,3Z)-4-[(1Z,3E)-4-(6-ethynylcyclohepta-1,3,5-trien-1-yl)buta-1,3-dienyl]sulfanylbuta-1,3-dienyl]cyclohepta-1,3,5-triene (PubChem CID 10522952) has the molecular formula C26H22S and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-ethynyl-6-[(1E,3Z)-4-[(1Z,3E)-4-(6-ethynylcyclohepta-1,3,5-trien-1-yl)buta-1,3-dienyl]sulfanylbuta-1,3-dienyl]cyclohepta-1,3,5-triene.
| Compound Name | 1-ethynyl-6-[(1E,3Z)-4-[(1Z,3E)-4-(6-ethynylcyclohepta-1,3,5-trien-1-yl)buta-1,3-dienyl]sulfanylbuta-1,3-dienyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 10522952 |
| Molecular Formula | C26H22S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-ethynyl-6-[(1E,3Z)-4-[(1Z,3E)-4-(6-ethynylcyclohepta-1,3,5-trien-1-yl)buta-1,3-dienyl]sulfanylbuta-1,3-dienyl]cyclohepta-1,3,5-triene |
| SMILES | C#CC1=CC=CC=C(/C=C/C=C\S/C=C\C=C\C2=CC=CC=C(C#C)C2)C1 |
| InChI | InChI=1S/C26H22S/c1-3-23-13-5-7-15-25(21-23)17-9-11-19-27-20-12-10-18-26-16-8-6-14-24(4-2)22-26/h1-2,5-20H,21-22H2/b17-9+,18-10+,19-11-,20-12- |
| InChIKey | UUZFWVVWVBZBBC-UXEDQDNHSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|