C13H9BrN2 — CID 11832553
(E)-2-bromo-3-[6-[(E)-2-cyanoethenyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enenitrile (PubChem CID 11832553) has the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. Its IUPAC name is (E)-2-bromo-3-[6-[(E)-2-cyanoethenyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enenitrile.
| Compound Name | (E)-2-bromo-3-[6-[(E)-2-cyanoethenyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11832553 |
| Molecular Formula | C13H9BrN2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | (E)-2-bromo-3-[6-[(E)-2-cyanoethenyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enenitrile |
| SMILES | N#C/C=C/C1=CC=CC=C(/C=C(/Br)C#N)C1 |
| InChI | InChI=1S/C13H9BrN2/c14-13(10-16)9-12-5-2-1-4-11(8-12)6-3-7-15/h1-6,9H,8H2/b6-3+,13-9+ |
| InChIKey | MWUILZVBEIYDNR-QUFQWADUSA-N |
| XLogP | 3.68 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|