C22H16O — CID 15203314
(1E,4E)-1-(6-ethynylcyclohepta-1,3,5-trien-1-yl)-5-(2-ethynylphenyl)penta-1,4-dien-3-one (PubChem CID 15203314) has the molecular formula C22H16O and a molecular weight of 296.37 g/mol. Its IUPAC name is (1E,4E)-1-(6-ethynylcyclohepta-1,3,5-trien-1-yl)-5-(2-ethynylphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(6-ethynylcyclohepta-1,3,5-trien-1-yl)-5-(2-ethynylphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 15203314 |
| Molecular Formula | C22H16O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1E,4E)-1-(6-ethynylcyclohepta-1,3,5-trien-1-yl)-5-(2-ethynylphenyl)penta-1,4-dien-3-one |
| SMILES | C#CC1=CC=CC=C(/C=C/C(=O)/C=C/c2ccccc2C#C)C1 |
| InChI | InChI=1S/C22H16O/c1-3-18-9-5-6-10-19(17-18)13-15-22(23)16-14-21-12-8-7-11-20(21)4-2/h1-2,5-16H,17H2/b15-13+,16-14+ |
| InChIKey | LMNVGLKJJYOOPV-WXUKJITCSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|