C24H28O — CID 143637313
(E)-3-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclohepta-1,3,5-trien-1-yl]prop-2-enal (PubChem CID 143637313) has the molecular formula C24H28O and a molecular weight of 332.49 g/mol. Its IUPAC name is (E)-3-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclohepta-1,3,5-trien-1-yl]prop-2-enal.
| Compound Name | (E)-3-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclohepta-1,3,5-trien-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 143637313 |
| Molecular Formula | C24H28O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (E)-3-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclohepta-1,3,5-trien-1-yl]prop-2-enal |
| SMILES | CC1(C)CCC(C)(C)c2cc(C3=CCC(/C=C/C=O)=CC=C3)ccc21 |
| InChI | InChI=1S/C24H28O/c1-23(2)14-15-24(3,4)22-17-20(12-13-21(22)23)19-9-5-7-18(10-11-19)8-6-16-25/h5-9,11-13,16-17H,10,14-15H2,1-4H3/b8-6+ |
| InChIKey | UYURVUBVUPXIRG-SOFGYWHQSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|