C37H46IN3O8 — CID 132564000
benzyl (2S)-4-[6-iodo-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 132564000) has the molecular formula C37H46IN3O8 and a molecular weight of 787.69 g/mol. Its IUPAC name is benzyl (2S)-4-[6-iodo-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl (2S)-4-[6-iodo-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 132564000 |
| Molecular Formula | C37H46IN3O8 |
| Molecular Weight | 787.69 g/mol |
| Exact Mass | 787.23 |
| IUPAC Name | benzyl (2S)-4-[6-iodo-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]-3-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCc1cnc(I)c(CC[C@H](NC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H46IN3O8/c1-36(2,3)48-34(44)40-29(32(42)46-23-25-13-9-7-10-14-25)19-17-27-21-28(31(38)39-22-27)18-20-30(41-35(45)49-37(4,5)6)33(43)47-24-26-15-11-8-12-16-26/h7-16,21-22,29-30H,17-20,23-24H2,1-6H3,(H,40,44)(H,41,45)/t29-,30-/m0/s1 |
| InChIKey | QUOQZWLZDKBEEU-KYJUHHDHSA-N |
| XLogP | 6.82 |
| TPSA | 142.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|