C23H18F2O5S — CID 132564560
[(Z)-3-(1,3-benzodioxol-5-yl)-3,3-difluoro-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 132564560) has the molecular formula C23H18F2O5S and a molecular weight of 444.46 g/mol. Its IUPAC name is [(Z)-3-(1,3-benzodioxol-5-yl)-3,3-difluoro-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-3-(1,3-benzodioxol-5-yl)-3,3-difluoro-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132564560 |
| Molecular Formula | C23H18F2O5S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [(Z)-3-(1,3-benzodioxol-5-yl)-3,3-difluoro-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/C(=C\c2ccccc2)C(F)(F)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H18F2O5S/c1-16-7-10-19(11-8-16)31(26,27)30-22(13-17-5-3-2-4-6-17)23(24,25)18-9-12-20-21(14-18)29-15-28-20/h2-14H,15H2,1H3/b22-13- |
| InChIKey | LDJFHIZZEANMCH-XKZIYDEJSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|