C18H14O2 — CID 132568398
2-(11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-3-yl)-1-phenylethanone (PubChem CID 132568398) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-3-yl)-1-phenylethanone.
| Compound Name | 2-(11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-3-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 132568398 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-(11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-3-yl)-1-phenylethanone |
| SMILES | O=C(Cc1cccc2c1C1C=CC2O1)c1ccccc1 |
| InChI | InChI=1S/C18H14O2/c19-15(12-5-2-1-3-6-12)11-13-7-4-8-14-16-9-10-17(20-16)18(13)14/h1-10,16-17H,11H2 |
| InChIKey | XVRGAGAZXHKFEN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|