C28H39NO6Si — CID 132570340
tert-butyl N-[(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-formyl-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 132570340) has the molecular formula C28H39NO6Si and a molecular weight of 513.71 g/mol. Its IUPAC name is tert-butyl N-[(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-formyl-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-formyl-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 132570340 |
| Molecular Formula | C28H39NO6Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | tert-butyl N-[(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-formyl-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)COC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C28H39NO6Si/c1-25(2,3)34-24(31)29-28(20-32-27(7,8)33-23(28)19-30)35-36(26(4,5)6,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-19,23H,20H2,1-8H3,(H,29,31)/t23-,28+/m0/s1 |
| InChIKey | KMZASRSLIJVHTC-NEKDWFFYSA-N |
| XLogP | 4.13 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|