C24H24N2O5 — CID 132571967
ethyl (2R,3R)-1-benzyl-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methyl-4-oxoazetidine-2-carboxylate (PubChem CID 132571967) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzyl-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methyl-4-oxoazetidine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzyl-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methyl-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 132571967 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl (2R,3R)-1-benzyl-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methyl-4-oxoazetidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCN2C(=O)c3ccccc3C2=O)[C@@H](C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N2O5/c1-3-31-23(30)24(16(2)20(27)26(24)15-17-9-5-4-6-10-17)13-14-25-21(28)18-11-7-8-12-19(18)22(25)29/h4-12,16H,3,13-15H2,1-2H3/t16-,24+/m0/s1 |
| InChIKey | DHGXNLZYPSXUSC-UPCLLVRISA-N |
| XLogP | 2.65 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|