C33H18F3N3O6 — CID 132572615
4,9,14-tris[(4-fluorophenyl)methyl]-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone (PubChem CID 132572615) has the molecular formula C33H18F3N3O6 and a molecular weight of 609.52 g/mol. Its IUPAC name is 4,9,14-tris[(4-fluorophenyl)methyl]-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone.
| Compound Name | 4,9,14-tris[(4-fluorophenyl)methyl]-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone |
|---|---|
| PubChem CID | 132572615 |
| Molecular Formula | C33H18F3N3O6 |
| Molecular Weight | 609.52 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | 4,9,14-tris[(4-fluorophenyl)methyl]-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone |
| SMILES | O=c1c2c3c(=O)n(Cc4ccc(F)cc4)c(=O)c3c3c(=O)n(Cc4ccc(F)cc4)c(=O)c3c2c(=O)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C33H18F3N3O6/c34-19-7-1-16(2-8-19)13-37-28(40)22-23(29(37)41)25-27(33(45)39(31(25)43)15-18-5-11-21(36)12-6-18)26-24(22)30(42)38(32(26)44)14-17-3-9-20(35)10-4-17/h1-12H,13-15H2 |
| InChIKey | LEQPXDUGKQEMAZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |