C54H94N4O6 — CID 132575165
2-[2-[[1-(2,5-dioctoxyanilino)-1-oxopropan-2-yl]-methylamino]ethyl-methylamino]-N-(2,5-dioctoxyphenyl)propanamide (PubChem CID 132575165) has the molecular formula C54H94N4O6 and a molecular weight of 895.37 g/mol. Its IUPAC name is 2-[2-[[1-(2,5-dioctoxyanilino)-1-oxopropan-2-yl]-methylamino]ethyl-methylamino]-N-(2,5-dioctoxyphenyl)propanamide.
| Compound Name | 2-[2-[[1-(2,5-dioctoxyanilino)-1-oxopropan-2-yl]-methylamino]ethyl-methylamino]-N-(2,5-dioctoxyphenyl)propanamide |
|---|---|
| PubChem CID | 132575165 |
| Molecular Formula | C54H94N4O6 |
| Molecular Weight | 895.37 g/mol |
| Exact Mass | 894.72 |
| IUPAC Name | 2-[2-[[1-(2,5-dioctoxyanilino)-1-oxopropan-2-yl]-methylamino]ethyl-methylamino]-N-(2,5-dioctoxyphenyl)propanamide |
| SMILES | CCCCCCCCOc1ccc(OCCCCCCCC)c(NC(=O)C(C)N(C)CCN(C)C(C)C(=O)Nc2cc(OCCCCCCCC)ccc2OCCCCCCCC)c1 |
| InChI | InChI=1S/C54H94N4O6/c1-9-13-17-21-25-29-39-61-47-33-35-51(63-41-31-27-23-19-15-11-3)49(43-47)55-53(59)45(5)57(7)37-38-58(8)46(6)54(60)56-50-44-48(62-40-30-26-22-18-14-10-2)34-36-52(50)64-42-32-28-24-20-16-12-4/h33-36,43-46H,9-32,37-42H2,1-8H3,(H,55,59)(H,56,60) |
| InChIKey | TUUKAXWWJCEFNS-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.37 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|