C19H26BNO4 — CID 132575396
methyl (3R,4R)-4-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 132575396) has the molecular formula C19H26BNO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is methyl (3R,4R)-4-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl (3R,4R)-4-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 132575396 |
| Molecular Formula | C19H26BNO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | methyl (3R,4R)-4-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1C=C[C@H](c2ccccc2)[C@@H](B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C19H26BNO4/c1-18(2)19(3,4)25-20(24-18)16-13-21(17(22)23-5)12-11-15(16)14-9-7-6-8-10-14/h6-12,15-16H,13H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | QOTCDHSIBBEFFV-CVEARBPZSA-N |
| XLogP | 3.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|