C27H27NSi — CID 132576091
N,2,6-trimethyl-N-triphenylsilylaniline (PubChem CID 132576091) has the molecular formula C27H27NSi and a molecular weight of 393.61 g/mol. Its IUPAC name is N,2,6-trimethyl-N-triphenylsilylaniline.
| Compound Name | N,2,6-trimethyl-N-triphenylsilylaniline |
|---|---|
| PubChem CID | 132576091 |
| Molecular Formula | C27H27NSi |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N,2,6-trimethyl-N-triphenylsilylaniline |
| SMILES | Cc1cccc(C)c1N(C)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NSi/c1-22-14-13-15-23(2)27(22)28(3)29(24-16-7-4-8-17-24,25-18-9-5-10-19-25)26-20-11-6-12-21-26/h4-21H,1-3H3 |
| InChIKey | ORILYEXXKWKDCY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|