C24H36N2 — CID 170108251
2-N,3-N-bis(2,6-dimethylphenyl)-2-N,3-N,2,3-tetramethylbutane-2,3-diamine (PubChem CID 170108251) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is 2-N,3-N-bis(2,6-dimethylphenyl)-2-N,3-N,2,3-tetramethylbutane-2,3-diamine.
| Compound Name | 2-N,3-N-bis(2,6-dimethylphenyl)-2-N,3-N,2,3-tetramethylbutane-2,3-diamine |
|---|---|
| PubChem CID | 170108251 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | 2-N,3-N-bis(2,6-dimethylphenyl)-2-N,3-N,2,3-tetramethylbutane-2,3-diamine |
| SMILES | Cc1cccc(C)c1N(C)C(C)(C)C(C)(C)N(C)c1c(C)cccc1C |
| InChI | InChI=1S/C24H36N2/c1-17-13-11-14-18(2)21(17)25(9)23(5,6)24(7,8)26(10)22-19(3)15-12-16-20(22)4/h11-16H,1-10H3 |
| InChIKey | YSVUPRHFFARTJC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |