C37H34N4O10 — CID 132577332
(E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(4-nitrophenyl)methoxy]-7-[(4-nitrophenyl)methylamino]-8-oxooct-4-enoic acid (PubChem CID 132577332) has the molecular formula C37H34N4O10 and a molecular weight of 694.70 g/mol. Its IUPAC name is (E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(4-nitrophenyl)methoxy]-7-[(4-nitrophenyl)methylamino]-8-oxooct-4-enoic acid.
| Compound Name | (E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(4-nitrophenyl)methoxy]-7-[(4-nitrophenyl)methylamino]-8-oxooct-4-enoic acid |
|---|---|
| PubChem CID | 132577332 |
| Molecular Formula | C37H34N4O10 |
| Molecular Weight | 694.70 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | (E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(4-nitrophenyl)methoxy]-7-[(4-nitrophenyl)methylamino]-8-oxooct-4-enoic acid |
| SMILES | O=C(NC(C/C=C/CC(NCc1ccc([N+](=O)[O-])cc1)C(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H34N4O10/c42-35(43)33(39-37(45)51-23-32-30-9-3-1-7-28(30)29-8-2-4-10-31(29)32)11-5-6-12-34(38-21-24-13-17-26(18-14-24)40(46)47)36(44)50-22-25-15-19-27(20-16-25)41(48)49/h1-10,13-20,32-34,38H,11-12,21-23H2,(H,39,45)(H,42,43)/b6-5+ |
| InChIKey | OCALVPHCDMHZOZ-AATRIKPKSA-N |
| XLogP | 6.03 |
| TPSA | 200.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|