C21H26O2Si — CID 132579303
(E)-1,2-diphenyl-3-triethylsilyloxyprop-2-en-1-one (PubChem CID 132579303) has the molecular formula C21H26O2Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (E)-1,2-diphenyl-3-triethylsilyloxyprop-2-en-1-one.
| Compound Name | (E)-1,2-diphenyl-3-triethylsilyloxyprop-2-en-1-one |
|---|---|
| PubChem CID | 132579303 |
| Molecular Formula | C21H26O2Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (E)-1,2-diphenyl-3-triethylsilyloxyprop-2-en-1-one |
| SMILES | CC[Si](CC)(CC)O/C=C(/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O2Si/c1-4-24(5-2,6-3)23-17-20(18-13-9-7-10-14-18)21(22)19-15-11-8-12-16-19/h7-17H,4-6H2,1-3H3/b20-17+ |
| InChIKey | ATBOCRWFPWMNDC-LVZFUZTISA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|