C23H21NO — CID 132583305
2-[(3,7-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol (PubChem CID 132583305) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[(3,7-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol.
| Compound Name | 2-[(3,7-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol |
|---|---|
| PubChem CID | 132583305 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(3,7-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol |
| SMILES | Cc1c(C(c2ccccc2)c2ccccc2O)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C23H21NO/c1-15-9-8-13-18-16(2)23(24-22(15)18)21(17-10-4-3-5-11-17)19-12-6-7-14-20(19)25/h3-14,21,24-25H,1-2H3 |
| InChIKey | CYPOPLVIXLMTEQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |