C17H17ClO3 — CID 132594318
(1S,2R,10R,11S,15R)-15-(chloromethyl)-1-hydroxy-12,15-dimethyl-9-oxatetracyclo[9.3.1.02,10.03,8]pentadeca-3,5,7,12-tetraen-14-one (PubChem CID 132594318) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is (1S,2R,10R,11S,15R)-15-(chloromethyl)-1-hydroxy-12,15-dimethyl-9-oxatetracyclo[9.3.1.02,10.03,8]pentadeca-3,5,7,12-tetraen-14-one.
| Compound Name | (1S,2R,10R,11S,15R)-15-(chloromethyl)-1-hydroxy-12,15-dimethyl-9-oxatetracyclo[9.3.1.02,10.03,8]pentadeca-3,5,7,12-tetraen-14-one |
|---|---|
| PubChem CID | 132594318 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (1S,2R,10R,11S,15R)-15-(chloromethyl)-1-hydroxy-12,15-dimethyl-9-oxatetracyclo[9.3.1.02,10.03,8]pentadeca-3,5,7,12-tetraen-14-one |
| SMILES | CC1=CC(=O)[C@]2(O)[C@@H]3c4ccccc4O[C@@H]3[C@@H]1[C@@]2(C)CCl |
| InChI | InChI=1S/C17H17ClO3/c1-9-7-12(19)17(20)14-10-5-3-4-6-11(10)21-15(14)13(9)16(17,2)8-18/h3-7,13-15,20H,8H2,1-2H3/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | LCIVAGCABXUBPM-HHARLNAUSA-N |
| XLogP | 2.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|