C13H14N2O3 — CID 132596164
5-(2,4,6-trimethoxyphenyl)pyrimidine (PubChem CID 132596164) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-(2,4,6-trimethoxyphenyl)pyrimidine.
| Compound Name | 5-(2,4,6-trimethoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 132596164 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-(2,4,6-trimethoxyphenyl)pyrimidine |
| SMILES | COc1cc(OC)c(-c2cncnc2)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-16-10-4-11(17-2)13(12(5-10)18-3)9-6-14-8-15-7-9/h4-8H,1-3H3 |
| InChIKey | VMGPDCNBXWRKGS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |