C20H16O4 — CID 132599077
(3R,3aR,5Z)-5-benzylidene-3-hydroxy-7-phenyl-3,3a-dihydro-2H-furo[3,2-b]pyran-6-one (PubChem CID 132599077) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is (3R,3aR,5Z)-5-benzylidene-3-hydroxy-7-phenyl-3,3a-dihydro-2H-furo[3,2-b]pyran-6-one.
| Compound Name | (3R,3aR,5Z)-5-benzylidene-3-hydroxy-7-phenyl-3,3a-dihydro-2H-furo[3,2-b]pyran-6-one |
|---|---|
| PubChem CID | 132599077 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (3R,3aR,5Z)-5-benzylidene-3-hydroxy-7-phenyl-3,3a-dihydro-2H-furo[3,2-b]pyran-6-one |
| SMILES | O=C1C(c2ccccc2)=C2OC[C@@H](O)[C@H]2O/C1=C\c1ccccc1 |
| InChI | InChI=1S/C20H16O4/c21-15-12-23-20-17(14-9-5-2-6-10-14)18(22)16(24-19(15)20)11-13-7-3-1-4-8-13/h1-11,15,19,21H,12H2/b16-11-/t15-,19-/m1/s1 |
| InChIKey | VDSXMGFSDMGSOG-BXLMWOKJSA-N |
| XLogP | 2.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|