C20H18N2O4 — CID 132599379
1-(4-methoxyphenyl)-2-[(4R,5R)-4-nitro-1,3,4,5-tetrahydrobenzo[cd]indol-5-yl]ethanone (PubChem CID 132599379) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[(4R,5R)-4-nitro-1,3,4,5-tetrahydrobenzo[cd]indol-5-yl]ethanone.
| Compound Name | 1-(4-methoxyphenyl)-2-[(4R,5R)-4-nitro-1,3,4,5-tetrahydrobenzo[cd]indol-5-yl]ethanone |
|---|---|
| PubChem CID | 132599379 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[(4R,5R)-4-nitro-1,3,4,5-tetrahydrobenzo[cd]indol-5-yl]ethanone |
| SMILES | COc1ccc(C(=O)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-26-14-7-5-12(6-8-14)19(23)10-16-15-3-2-4-17-20(15)13(11-21-17)9-18(16)22(24)25/h2-8,11,16,18,21H,9-10H2,1H3/t16-,18-/m1/s1 |
| InChIKey | BMDDAMTYKFQCRJ-SJLPKXTDSA-N |
| XLogP | 3.73 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|