C18H16F3NO — CID 132602178
2,6-diphenyl-6-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-oxazine (PubChem CID 132602178) has the molecular formula C18H16F3NO and a molecular weight of 319.33 g/mol. Its IUPAC name is 2,6-diphenyl-6-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-oxazine.
| Compound Name | 2,6-diphenyl-6-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 132602178 |
| Molecular Formula | C18H16F3NO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2,6-diphenyl-6-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-oxazine |
| SMILES | FC(F)(F)CC1(c2ccccc2)CCN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C18H16F3NO/c19-18(20,21)13-17(15-9-5-2-6-10-15)11-12-22-16(23-17)14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | ODUHGPRGPFGFQU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |