C17H13BrF3NO — CID 135035338
(5R)-5-(bromomethyl)-2-phenyl-5-[3-(trifluoromethyl)phenyl]-4H-1,3-oxazole (PubChem CID 135035338) has the molecular formula C17H13BrF3NO and a molecular weight of 384.20 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-2-phenyl-5-[3-(trifluoromethyl)phenyl]-4H-1,3-oxazole.
| Compound Name | (5R)-5-(bromomethyl)-2-phenyl-5-[3-(trifluoromethyl)phenyl]-4H-1,3-oxazole |
|---|---|
| PubChem CID | 135035338 |
| Molecular Formula | C17H13BrF3NO |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | (5R)-5-(bromomethyl)-2-phenyl-5-[3-(trifluoromethyl)phenyl]-4H-1,3-oxazole |
| SMILES | FC(F)(F)c1cccc([C@]2(CBr)CN=C(c3ccccc3)O2)c1 |
| InChI | InChI=1S/C17H13BrF3NO/c18-10-16(13-7-4-8-14(9-13)17(19,20)21)11-22-15(23-16)12-5-2-1-3-6-12/h1-9H,10-11H2/t16-/m0/s1 |
| InChIKey | HJOXNFDJSMLALY-INIZCTEOSA-N |
| XLogP | 4.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|