C17H14BrF2NO — CID 155929132
(5R)-5-[bromo(difluoro)methyl]-5-(4-methylphenyl)-2-phenyl-4H-1,3-oxazole (PubChem CID 155929132) has the molecular formula C17H14BrF2NO and a molecular weight of 366.21 g/mol. Its IUPAC name is (5R)-5-[bromo(difluoro)methyl]-5-(4-methylphenyl)-2-phenyl-4H-1,3-oxazole.
| Compound Name | (5R)-5-[bromo(difluoro)methyl]-5-(4-methylphenyl)-2-phenyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 155929132 |
| Molecular Formula | C17H14BrF2NO |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | (5R)-5-[bromo(difluoro)methyl]-5-(4-methylphenyl)-2-phenyl-4H-1,3-oxazole |
| SMILES | Cc1ccc([C@]2(C(F)(F)Br)CN=C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C17H14BrF2NO/c1-12-7-9-14(10-8-12)16(17(18,19)20)11-21-15(22-16)13-5-3-2-4-6-13/h2-10H,11H2,1H3/t16-/m0/s1 |
| InChIKey | PBINTHLVUCZZSU-INIZCTEOSA-N |
| XLogP | 4.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|