C16H13BrFNO — CID 135035337
(5R)-5-(bromomethyl)-5-(4-fluorophenyl)-2-phenyl-4H-1,3-oxazole (PubChem CID 135035337) has the molecular formula C16H13BrFNO and a molecular weight of 334.19 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-5-(4-fluorophenyl)-2-phenyl-4H-1,3-oxazole.
| Compound Name | (5R)-5-(bromomethyl)-5-(4-fluorophenyl)-2-phenyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 135035337 |
| Molecular Formula | C16H13BrFNO |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | (5R)-5-(bromomethyl)-5-(4-fluorophenyl)-2-phenyl-4H-1,3-oxazole |
| SMILES | Fc1ccc([C@]2(CBr)CN=C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C16H13BrFNO/c17-10-16(13-6-8-14(18)9-7-13)11-19-15(20-16)12-4-2-1-3-5-12/h1-9H,10-11H2/t16-/m0/s1 |
| InChIKey | ATCWCRZUWQEBMG-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|