C19H28N3O2S2 — CID 132602337
CID 132602337 (PubChem CID 132602337) has the molecular formula C19H28N3O2S2 and a molecular weight of 394.59 g/mol.
| Compound Name | CID 132602337 |
|---|---|
| PubChem CID | 132602337 |
| Molecular Formula | C19H28N3O2S2 |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | — |
| SMILES | CNC(CSSCC1=C(c2cccnc2)C(C)(C)N([O])C1(C)C)C(C)=O |
| InChI | InChI=1S/C19H28N3O2S2/c1-13(23)16(20-6)12-26-25-11-15-17(14-8-7-9-21-10-14)19(4,5)22(24)18(15,2)3/h7-10,16,20H,11-12H2,1-6H3 |
| InChIKey | YBUMKUZFFOFZGG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|