About 2-(4-fluoroanilino)naphthalene-1,4-diol
2-(4-fluoroanilino)naphthalene-1,4-diol (PubChem CID 132604540) has the molecular formula C16H12FNO2
and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-(4-fluoroanilino)naphthalene-1,4-diol.
Molecular Properties
| Compound Name | 2-(4-fluoroanilino)naphthalene-1,4-diol |
| PubChem CID | 132604540 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-(4-fluoroanilino)naphthalene-1,4-diol |
| SMILES | Oc1cc(Nc2ccc(F)cc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C16H12FNO2/c17-10-5-7-11(8-6-10)18-14-9-15(19)12-3-1-2-4-13(12)16(14)20/h1-9,18-20H |
| InChIKey | WCVANDMHQADCHP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluoroanilino)naphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoroanilino)naphthalene-1,4-diol?
The IUPAC name of 2-(4-fluoroanilino)naphthalene-1,4-diol (CID 132604540) is 2-(4-fluoroanilino)naphthalene-1,4-diol.
What is the SMILES notation for 2-(4-fluoroanilino)naphthalene-1,4-diol?
The canonical SMILES for 2-(4-fluoroanilino)naphthalene-1,4-diol is Oc1cc(Nc2ccc(F)cc2)c(O)c2ccccc12.
What is the InChIKey of 2-(4-fluoroanilino)naphthalene-1,4-diol?
The InChIKey is WCVANDMHQADCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO2/c17-10-5-7-11(8-6-10)18-14-9-15(19)12-3-1-2-4-13(12)16(14)20/h1-9,18-20H.
What are the key properties of 2-(4-fluoroanilino)naphthalene-1,4-diol?
2-(4-fluoroanilino)naphthalene-1,4-diol has a molecular weight of 269.28 g/mol, XLogP of 4.13, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoroanilino)naphthalene-1,4-diol is sourced from PubChem (CID 132604540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).