C21H23NO — CID 132605228
4-[2-(4-ethynyl-1-bicyclo[2.2.2]octanyl)ethynyl]-N,N-dimethylbenzamide (PubChem CID 132605228) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[2-(4-ethynyl-1-bicyclo[2.2.2]octanyl)ethynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[2-(4-ethynyl-1-bicyclo[2.2.2]octanyl)ethynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 132605228 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-[2-(4-ethynyl-1-bicyclo[2.2.2]octanyl)ethynyl]-N,N-dimethylbenzamide |
| SMILES | C#CC12CCC(C#Cc3ccc(C(=O)N(C)C)cc3)(CC1)CC2 |
| InChI | InChI=1S/C21H23NO/c1-4-20-11-14-21(15-12-20,16-13-20)10-9-17-5-7-18(8-6-17)19(23)22(2)3/h1,5-8H,11-16H2,2-3H3 |
| InChIKey | ZYXJPOGRMNHNCQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|