C10H19NO3 — CID 132605247
(1S,2R,7S,8aS)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-1,2,7-triol (PubChem CID 132605247) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (1S,2R,7S,8aS)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-1,2,7-triol.
| Compound Name | (1S,2R,7S,8aS)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-1,2,7-triol |
|---|---|
| PubChem CID | 132605247 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (1S,2R,7S,8aS)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-1,2,7-triol |
| SMILES | CC1(C)C[C@@H](O)C[C@H]2[C@H](O)[C@H](O)CN21 |
| InChI | InChI=1S/C10H19NO3/c1-10(2)4-6(12)3-7-9(14)8(13)5-11(7)10/h6-9,12-14H,3-5H2,1-2H3/t6-,7-,8+,9-/m0/s1 |
| InChIKey | ANFXJHMBDTTYHV-MAUMQABQSA-N |
| XLogP | -0.67 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |