C20H24F3N — CID 132605790
1-[1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine (PubChem CID 132605790) has the molecular formula C20H24F3N and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine.
| Compound Name | 1-[1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine |
|---|---|
| PubChem CID | 132605790 |
| Molecular Formula | C20H24F3N |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine |
| SMILES | FC(F)(F)c1ccc(C#CC(C2CCCCC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H24F3N/c21-20(22,23)18-11-8-16(9-12-18)10-13-19(24-14-4-5-15-24)17-6-2-1-3-7-17/h8-9,11-12,17,19H,1-7,14-15H2 |
| InChIKey | CTAKTJAXGOGJCO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|