C23H30F3NO2 — CID 143215706
acetic acid;1-(1-cyclopropyl-4-methylpent-4-en-2-ynyl)piperidine;trifluoromethylbenzene (PubChem CID 143215706) has the molecular formula C23H30F3NO2 and a molecular weight of 409.49 g/mol. Its IUPAC name is acetic acid;1-(1-cyclopropyl-4-methylpent-4-en-2-ynyl)piperidine;trifluoromethylbenzene.
| Compound Name | acetic acid;1-(1-cyclopropyl-4-methylpent-4-en-2-ynyl)piperidine;trifluoromethylbenzene |
|---|---|
| PubChem CID | 143215706 |
| Molecular Formula | C23H30F3NO2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | acetic acid;1-(1-cyclopropyl-4-methylpent-4-en-2-ynyl)piperidine;trifluoromethylbenzene |
| SMILES | C=C(C)C#CC(C1CC1)N1CCCCC1.CC(=O)O.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C14H21N.C7H5F3.C2H4O2/c1-12(2)6-9-14(13-7-8-13)15-10-4-3-5-11-15;8-7(9,10)6-4-2-1-3-5-6;1-2(3)4/h13-14H,1,3-5,7-8,10-11H2,2H3;1-5H;1H3,(H,3,4) |
| InChIKey | QTVJKNOABOHZEB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|