C26H33ClN2O2S — CID 132615853
2-[3-benzylsulfanylpropanoyl-[(2-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide (PubChem CID 132615853) has the molecular formula C26H33ClN2O2S and a molecular weight of 473.08 g/mol. Its IUPAC name is 2-[3-benzylsulfanylpropanoyl-[(2-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[3-benzylsulfanylpropanoyl-[(2-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 132615853 |
| Molecular Formula | C26H33ClN2O2S |
| Molecular Weight | 473.08 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[3-benzylsulfanylpropanoyl-[(2-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1ccccc1Cl)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C26H33ClN2O2S/c1-20(26(31)28-23-13-6-3-7-14-23)29(18-22-12-8-9-15-24(22)27)25(30)16-17-32-19-21-10-4-2-5-11-21/h2,4-5,8-12,15,20,23H,3,6-7,13-14,16-19H2,1H3,(H,28,31) |
| InChIKey | YOQNGKOYJYOBJN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.08 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|